C17H24ClN3O — CID 89146018
(2R)-2-amino-1-[6-(4-chlorophenyl)-1-methyl-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3-methylbutan-1-one (PubChem CID 89146018) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is (2R)-2-amino-1-[6-(4-chlorophenyl)-1-methyl-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3-methylbutan-1-one.
| Compound Name | (2R)-2-amino-1-[6-(4-chlorophenyl)-1-methyl-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 89146018 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2R)-2-amino-1-[6-(4-chlorophenyl)-1-methyl-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3-methylbutan-1-one |
| SMILES | CC(C)[C@@H](N)C(=O)N1CCC2(c3ccc(Cl)cc3)NC2(C)C1 |
| InChI | InChI=1S/C17H24ClN3O/c1-11(2)14(19)15(22)21-9-8-17(16(3,10-21)20-17)12-4-6-13(18)7-5-12/h4-7,11,14,20H,8-10,19H2,1-3H3/t14-,16?,17?/m1/s1 |
| InChIKey | PXVQDWIFQUDTAJ-ODIFPOPNSA-N |
| XLogP | 2.11 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|