C21H26N2O4 — CID 67305617
tert-butyl N-[3-[3-(dimethylamino)prop-2-enoyl]-7-methoxynaphthalen-1-yl]carbamate (PubChem CID 67305617) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(dimethylamino)prop-2-enoyl]-7-methoxynaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(dimethylamino)prop-2-enoyl]-7-methoxynaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 67305617 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl N-[3-[3-(dimethylamino)prop-2-enoyl]-7-methoxynaphthalen-1-yl]carbamate |
| SMILES | COc1ccc2cc(C(=O)C=CN(C)C)cc(NC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,3)27-20(25)22-18-12-15(19(24)9-10-23(4)5)11-14-7-8-16(26-6)13-17(14)18/h7-13H,1-6H3,(H,22,25) |
| InChIKey | NMRRBUJBBPCRFP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|