C20H22N2O3 — CID 67306259
2-[5-(4-amino-2-methylphenyl)-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid (PubChem CID 67306259) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[5-(4-amino-2-methylphenyl)-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid.
| Compound Name | 2-[5-(4-amino-2-methylphenyl)-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67306259 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-[5-(4-amino-2-methylphenyl)-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid |
| SMILES | Cc1cc(N)ccc1-c1ccc2c(c1)C(=O)N(C(C(=O)O)C(C)C)C2 |
| InChI | InChI=1S/C20H22N2O3/c1-11(2)18(20(24)25)22-10-14-5-4-13(9-17(14)19(22)23)16-7-6-15(21)8-12(16)3/h4-9,11,18H,10,21H2,1-3H3,(H,24,25) |
| InChIKey | RTOWJGIMWXULFR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|