C31H34N2O6 — CID 67306972
(2S)-2-[5-[4-[(4-butoxybenzoyl)amino]-2-methoxyphenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid (PubChem CID 67306972) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is (2S)-2-[5-[4-[(4-butoxybenzoyl)amino]-2-methoxyphenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[5-[4-[(4-butoxybenzoyl)amino]-2-methoxyphenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67306972 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | (2S)-2-[5-[4-[(4-butoxybenzoyl)amino]-2-methoxyphenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(-c3ccc4c(c3)C(=O)N([C@H](C(=O)O)C(C)C)C4)c(OC)c2)cc1 |
| InChI | InChI=1S/C31H34N2O6/c1-5-6-15-39-24-12-9-20(10-13-24)29(34)32-23-11-14-25(27(17-23)38-4)21-7-8-22-18-33(30(35)26(22)16-21)28(19(2)3)31(36)37/h7-14,16-17,19,28H,5-6,15,18H2,1-4H3,(H,32,34)(H,36,37)/t28-/m0/s1 |
| InChIKey | OIKVESCQEIUQMH-NDEPHWFRSA-N |
| XLogP | 5.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|