C32H36N2O4 — CID 67307584
(2S)-3-methyl-2-[5-[2-methyl-4-[(4-pentylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoic acid (PubChem CID 67307584) has the molecular formula C32H36N2O4 and a molecular weight of 512.65 g/mol. Its IUPAC name is (2S)-3-methyl-2-[5-[2-methyl-4-[(4-pentylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[5-[2-methyl-4-[(4-pentylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 67307584 |
| Molecular Formula | C32H36N2O4 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | (2S)-3-methyl-2-[5-[2-methyl-4-[(4-pentylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoic acid |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(-c3ccc4c(c3)C(=O)N([C@H](C(=O)O)C(C)C)C4)c(C)c2)cc1 |
| InChI | InChI=1S/C32H36N2O4/c1-5-6-7-8-22-9-11-23(12-10-22)30(35)33-26-15-16-27(21(4)17-26)24-13-14-25-19-34(31(36)28(25)18-24)29(20(2)3)32(37)38/h9-18,20,29H,5-8,19H2,1-4H3,(H,33,35)(H,37,38)/t29-/m0/s1 |
| InChIKey | YASTYLYOPZZAAA-LJAQVGFWSA-N |
| XLogP | 6.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|