C29H33N3O3 — CID 67344680
(2S)-3-methyl-2-[3-oxo-5-[5-(4-pentylanilino)-2-pyridinyl]-1H-isoindol-2-yl]butanoic acid (PubChem CID 67344680) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is (2S)-3-methyl-2-[3-oxo-5-[5-(4-pentylanilino)-2-pyridinyl]-1H-isoindol-2-yl]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[3-oxo-5-[5-(4-pentylanilino)-2-pyridinyl]-1H-isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 67344680 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (2S)-3-methyl-2-[3-oxo-5-[5-(4-pentylanilino)-2-pyridinyl]-1H-isoindol-2-yl]butanoic acid |
| SMILES | CCCCCc1ccc(Nc2ccc(-c3ccc4c(c3)C(=O)N([C@H](C(=O)O)C(C)C)C4)nc2)cc1 |
| InChI | InChI=1S/C29H33N3O3/c1-4-5-6-7-20-8-12-23(13-9-20)31-24-14-15-26(30-17-24)21-10-11-22-18-32(28(33)25(22)16-21)27(19(2)3)29(34)35/h8-17,19,27,31H,4-7,18H2,1-3H3,(H,34,35)/t27-/m0/s1 |
| InChIKey | FEHVZKAYEBHURT-MHZLTWQESA-N |
| XLogP | 6.29 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|