C31H35N3O4 — CID 67306796
methyl 3-methyl-2-[3-oxo-5-[5-[(4-pentylbenzoyl)amino]-2-pyridinyl]-1H-isoindol-2-yl]butanoate (PubChem CID 67306796) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is methyl 3-methyl-2-[3-oxo-5-[5-[(4-pentylbenzoyl)amino]-2-pyridinyl]-1H-isoindol-2-yl]butanoate.
| Compound Name | methyl 3-methyl-2-[3-oxo-5-[5-[(4-pentylbenzoyl)amino]-2-pyridinyl]-1H-isoindol-2-yl]butanoate |
|---|---|
| PubChem CID | 67306796 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | methyl 3-methyl-2-[3-oxo-5-[5-[(4-pentylbenzoyl)amino]-2-pyridinyl]-1H-isoindol-2-yl]butanoate |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(-c3ccc4c(c3)C(=O)N(C(C(=O)OC)C(C)C)C4)nc2)cc1 |
| InChI | InChI=1S/C31H35N3O4/c1-5-6-7-8-21-9-11-22(12-10-21)29(35)33-25-15-16-27(32-18-25)23-13-14-24-19-34(30(36)26(24)17-23)28(20(2)3)31(37)38-4/h9-18,20,28H,5-8,19H2,1-4H3,(H,33,35) |
| InChIKey | PZGFMBHLSQDULB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|