C24H30FN3O5 — CID 67309787
N-[(4-fluorophenyl)methyl]-3,9-dihydroxy-1,8-dioxo-2-(2,4,4-trimethylpentan-2-yl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 67309787) has the molecular formula C24H30FN3O5 and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3,9-dihydroxy-1,8-dioxo-2-(2,4,4-trimethylpentan-2-yl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3,9-dihydroxy-1,8-dioxo-2-(2,4,4-trimethylpentan-2-yl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 67309787 |
| Molecular Formula | C24H30FN3O5 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3,9-dihydroxy-1,8-dioxo-2-(2,4,4-trimethylpentan-2-yl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)N1C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(F)cc3)cn2CC1O |
| InChI | InChI=1S/C24H30FN3O5/c1-23(2,3)13-24(4,5)28-17(29)12-27-11-16(19(30)20(31)18(27)22(28)33)21(32)26-10-14-6-8-15(25)9-7-14/h6-9,11,17,29,31H,10,12-13H2,1-5H3,(H,26,32) |
| InChIKey | UTSVEWWKOIKGGQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |