C23H22FN5O4S — CID 66594335
N-[(4-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-(1,3-thiazol-2-ylmethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 66594335) has the molecular formula C23H22FN5O4S and a molecular weight of 483.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-(1,3-thiazol-2-ylmethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-(1,3-thiazol-2-ylmethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 66594335 |
| Molecular Formula | C23H22FN5O4S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-4-(1,3-thiazol-2-ylmethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cn2c(c(O)c1=O)C(=O)N1CCCN(Cc3nccs3)C1C2 |
| InChI | InChI=1S/C23H22FN5O4S/c24-15-4-2-14(3-5-15)10-26-22(32)16-11-28-13-18-27(12-17-25-6-9-34-17)7-1-8-29(18)23(33)19(28)21(31)20(16)30/h2-6,9,11,18,31H,1,7-8,10,12-13H2,(H,26,32) |
| InChIKey | NRYREYIXVNMORQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |