C20H21N3O6 — CID 90799930
11-hydroxy-4-[(4-methoxyphenyl)methyl]-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid (PubChem CID 90799930) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 11-hydroxy-4-[(4-methoxyphenyl)methyl]-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid.
| Compound Name | 11-hydroxy-4-[(4-methoxyphenyl)methyl]-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid |
|---|---|
| PubChem CID | 90799930 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 11-hydroxy-4-[(4-methoxyphenyl)methyl]-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid |
| SMILES | COc1ccc(CN2CCCN3C(=O)c4c(O)c(=O)c(C(=O)O)cn4CC23)cc1 |
| InChI | InChI=1S/C20H21N3O6/c1-29-13-5-3-12(4-6-13)9-21-7-2-8-23-15(21)11-22-10-14(20(27)28)17(24)18(25)16(22)19(23)26/h3-6,10,15,25H,2,7-9,11H2,1H3,(H,27,28) |
| InChIKey | BTIRFXLQTYLEPX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |