C21H25FN4O5 — CID 138618895
(4-fluorophenyl)methanamine;4-hydroxy-11-methyl-2,5-dioxo-1,8,11-triazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid (PubChem CID 138618895) has the molecular formula C21H25FN4O5 and a molecular weight of 432.45 g/mol. Its IUPAC name is (4-fluorophenyl)methanamine;4-hydroxy-11-methyl-2,5-dioxo-1,8,11-triazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid.
| Compound Name | (4-fluorophenyl)methanamine;4-hydroxy-11-methyl-2,5-dioxo-1,8,11-triazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid |
|---|---|
| PubChem CID | 138618895 |
| Molecular Formula | C21H25FN4O5 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (4-fluorophenyl)methanamine;4-hydroxy-11-methyl-2,5-dioxo-1,8,11-triazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxylic acid |
| SMILES | CN1CCCCN2C(=O)c3c(O)c(=O)c(C(=O)O)cn3CC12.NCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H17N3O5.C7H8FN/c1-15-4-2-3-5-17-9(15)7-16-6-8(14(21)22)11(18)12(19)10(16)13(17)20;8-7-3-1-6(5-9)2-4-7/h6,9,19H,2-5,7H2,1H3,(H,21,22);1-4H,5,9H2 |
| InChIKey | ZOWOTSOZQCVPJI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |