C17H23N3O6 — CID 90974568
11-hydroxy-9,12-dioxo-4-(2-propan-2-yloxyethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid (PubChem CID 90974568) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is 11-hydroxy-9,12-dioxo-4-(2-propan-2-yloxyethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid.
| Compound Name | 11-hydroxy-9,12-dioxo-4-(2-propan-2-yloxyethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid |
|---|---|
| PubChem CID | 90974568 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 11-hydroxy-9,12-dioxo-4-(2-propan-2-yloxyethyl)-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid |
| SMILES | CC(C)OCCN1CCCN2C(=O)c3c(O)c(=O)c(C(=O)O)cn3CC12 |
| InChI | InChI=1S/C17H23N3O6/c1-10(2)26-7-6-18-4-3-5-20-12(18)9-19-8-11(17(24)25)14(21)15(22)13(19)16(20)23/h8,10,12,22H,3-7,9H2,1-2H3,(H,24,25) |
| InChIKey | ZQMSQJVMZZLNSS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |