C13H16N2O7 — CID 90869095
3,9-dihydroxy-2-(3-methoxypropyl)-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid (PubChem CID 90869095) has the molecular formula C13H16N2O7 and a molecular weight of 312.28 g/mol. Its IUPAC name is 3,9-dihydroxy-2-(3-methoxypropyl)-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid.
| Compound Name | 3,9-dihydroxy-2-(3-methoxypropyl)-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 90869095 |
| Molecular Formula | C13H16N2O7 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3,9-dihydroxy-2-(3-methoxypropyl)-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid |
| SMILES | COCCCN1C(=O)c2c(O)c(=O)c(C(=O)O)cn2CC1O |
| InChI | InChI=1S/C13H16N2O7/c1-22-4-2-3-15-8(16)6-14-5-7(13(20)21)10(17)11(18)9(14)12(15)19/h5,8,16,18H,2-4,6H2,1H3,(H,20,21) |
| InChIKey | SCOYCTXYJRZSNE-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|