C19H20N2O6 — CID 91500788
3,9-dihydroxy-1,8-dioxo-2-(4-phenylbutyl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid (PubChem CID 91500788) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is 3,9-dihydroxy-1,8-dioxo-2-(4-phenylbutyl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid.
| Compound Name | 3,9-dihydroxy-1,8-dioxo-2-(4-phenylbutyl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 91500788 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3,9-dihydroxy-1,8-dioxo-2-(4-phenylbutyl)-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid |
| SMILES | O=C(O)c1cn2c(c(O)c1=O)C(=O)N(CCCCc1ccccc1)C(O)C2 |
| InChI | InChI=1S/C19H20N2O6/c22-14-11-20-10-13(19(26)27)16(23)17(24)15(20)18(25)21(14)9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,10,14,22,24H,4-5,8-9,11H2,(H,26,27) |
| InChIKey | HJGIHUXZZDCHHQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|