C22H18F2N4O4 — CID 68941494
N,2-bis[(4-fluorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-d][1,2,4]triazine-7-carboxamide (PubChem CID 68941494) has the molecular formula C22H18F2N4O4 and a molecular weight of 440.41 g/mol. Its IUPAC name is N,2-bis[(4-fluorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-d][1,2,4]triazine-7-carboxamide.
| Compound Name | N,2-bis[(4-fluorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-d][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 68941494 |
| Molecular Formula | C22H18F2N4O4 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N,2-bis[(4-fluorophenyl)methyl]-9-hydroxy-1,8-dioxo-3,4-dihydropyrido[1,2-d][1,2,4]triazine-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cn2c(c(O)c1=O)C(=O)N(Cc1ccc(F)cc1)NC2 |
| InChI | InChI=1S/C22H18F2N4O4/c23-15-5-1-13(2-6-15)9-25-21(31)17-11-27-12-26-28(10-14-3-7-16(24)8-4-14)22(32)18(27)20(30)19(17)29/h1-8,11,26,30H,9-10,12H2,(H,25,31) |
| InChIKey | JTNXMHQYUYWINE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |