C22H30N6O3 — CID 67311800
4-[[2-(2-cyclohexylethoxy)-4-pyridinyl]oxy]-N-pyrazin-2-ylpiperazine-1-carboxamide (PubChem CID 67311800) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[[2-(2-cyclohexylethoxy)-4-pyridinyl]oxy]-N-pyrazin-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[[2-(2-cyclohexylethoxy)-4-pyridinyl]oxy]-N-pyrazin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 67311800 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-[[2-(2-cyclohexylethoxy)-4-pyridinyl]oxy]-N-pyrazin-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cnccn1)N1CCN(Oc2ccnc(OCCC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C22H30N6O3/c29-22(26-20-17-23-9-10-24-20)27-11-13-28(14-12-27)31-19-6-8-25-21(16-19)30-15-7-18-4-2-1-3-5-18/h6,8-10,16-18H,1-5,7,11-15H2,(H,24,26,29) |
| InChIKey | NYJOFNAXYNFNHC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |