C14H23N3O6 — CID 67312423
2-(2-amino-3-carboxypropanoyl)-1-(2-amino-3-methylbutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 67312423) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-(2-amino-3-carboxypropanoyl)-1-(2-amino-3-methylbutanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(2-amino-3-carboxypropanoyl)-1-(2-amino-3-methylbutanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67312423 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(2-amino-3-carboxypropanoyl)-1-(2-amino-3-methylbutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C(N)C(=O)N1CCCC1(C(=O)O)C(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C14H23N3O6/c1-7(2)10(16)12(21)17-5-3-4-14(17,13(22)23)11(20)8(15)6-9(18)19/h7-8,10H,3-6,15-16H2,1-2H3,(H,18,19)(H,22,23) |
| InChIKey | SPDJJAINAAEDAV-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|