C16H28N4O4 — CID 70493103
2-(2,6-diaminohexanoyl)-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 70493103) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(2,6-diaminohexanoyl)-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(2,6-diaminohexanoyl)-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70493103 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 2-(2,6-diaminohexanoyl)-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)C1(C(=O)O)CCCN1C(=O)C1CCCN1 |
| InChI | InChI=1S/C16H28N4O4/c17-8-2-1-5-11(18)13(21)16(15(23)24)7-4-10-20(16)14(22)12-6-3-9-19-12/h11-12,19H,1-10,17-18H2,(H,23,24) |
| InChIKey | UEYNGDBJMLSMLB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|