C11H19ClN2O4S — CID 87856019
(2S)-2-(2-aminoacetyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 87856019) has the molecular formula C11H19ClN2O4S and a molecular weight of 310.80 g/mol. Its IUPAC name is (2S)-2-(2-aminoacetyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S)-2-(2-aminoacetyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 87856019 |
| Molecular Formula | C11H19ClN2O4S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (2S)-2-(2-aminoacetyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | CC(CS)C(=O)N1CCC[C@@]1(C(=O)O)C(=O)CN.Cl |
| InChI | InChI=1S/C11H18N2O4S.ClH/c1-7(6-18)9(15)13-4-2-3-11(13,10(16)17)8(14)5-12;/h7,18H,2-6,12H2,1H3,(H,16,17);1H/t7?,11-;/m0./s1 |
| InChIKey | BNGXIWJJKCPQMD-LFMNOWIXSA-N |
| XLogP | -0.05 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|