C15H26ClN3O7S — CID 87856238
3-nitrooxypropyl (2S)-2-[(2S)-2-aminopropanoyl]-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 87856238) has the molecular formula C15H26ClN3O7S and a molecular weight of 427.91 g/mol. Its IUPAC name is 3-nitrooxypropyl (2S)-2-[(2S)-2-aminopropanoyl]-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | 3-nitrooxypropyl (2S)-2-[(2S)-2-aminopropanoyl]-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 87856238 |
| Molecular Formula | C15H26ClN3O7S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-nitrooxypropyl (2S)-2-[(2S)-2-aminopropanoyl]-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | CC(CS)C(=O)N1CCC[C@@]1(C(=O)OCCCO[N+](=O)[O-])C(=O)[C@H](C)N.Cl |
| InChI | InChI=1S/C15H25N3O7S.ClH/c1-10(9-26)13(20)17-6-3-5-15(17,12(19)11(2)16)14(21)24-7-4-8-25-18(22)23;/h10-11,26H,3-9,16H2,1-2H3;1H/t10?,11-,15-;/m0./s1 |
| InChIKey | CBKXNFJAZQJKRJ-BMKXMKBASA-N |
| XLogP | 0.39 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|