C15H23Cl2NO3 — CID 67314028
8-(2-amino-4-chlorophenoxy)-2-methyloctanoic acid;hydrochloride (PubChem CID 67314028) has the molecular formula C15H23Cl2NO3 and a molecular weight of 336.26 g/mol. Its IUPAC name is 8-(2-amino-4-chlorophenoxy)-2-methyloctanoic acid;hydrochloride.
| Compound Name | 8-(2-amino-4-chlorophenoxy)-2-methyloctanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67314028 |
| Molecular Formula | C15H23Cl2NO3 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 8-(2-amino-4-chlorophenoxy)-2-methyloctanoic acid;hydrochloride |
| SMILES | CC(CCCCCCOc1ccc(Cl)cc1N)C(=O)O.Cl |
| InChI | InChI=1S/C15H22ClNO3.ClH/c1-11(15(18)19)6-4-2-3-5-9-20-14-8-7-12(16)10-13(14)17;/h7-8,10-11H,2-6,9,17H2,1H3,(H,18,19);1H |
| InChIKey | XHXUPEGYTCXREJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|