C7H4F3NO2S — CID 67315313
5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide (PubChem CID 67315313) has the molecular formula C7H4F3NO2S and a molecular weight of 223.17 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide.
| Compound Name | 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67315313 |
| Molecular Formula | C7H4F3NO2S |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(C(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H4F3NO2S/c8-7(9,10)5(12)3-1-2-4(14-3)6(11)13/h1-2H,(H2,11,13) |
| InChIKey | ZELCAHZQAFVEPY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |