C23H29F2N3O2 — CID 67317576
(4,4-difluoropiperidin-1-yl)-[8-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone (PubChem CID 67317576) has the molecular formula C23H29F2N3O2 and a molecular weight of 417.50 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[8-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[8-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone |
|---|---|
| PubChem CID | 67317576 |
| Molecular Formula | C23H29F2N3O2 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[8-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone |
| SMILES | O=C(c1ccc2cccc(OCCCN3CCCCC3)c2n1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C23H29F2N3O2/c24-23(25)10-15-28(16-11-23)22(29)19-9-8-18-6-4-7-20(21(18)26-19)30-17-5-14-27-12-2-1-3-13-27/h4,6-9H,1-3,5,10-17H2 |
| InChIKey | HTPWKASQWDRGAN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|