C20H28F2N2O2 — CID 90685177
(4,4-difluoropiperidin-1-yl)-[2-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]methanone (PubChem CID 90685177) has the molecular formula C20H28F2N2O2 and a molecular weight of 366.45 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[2-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[2-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 90685177 |
| Molecular Formula | C20H28F2N2O2 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[2-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]methanone |
| SMILES | CC1CCCN1CCCOc1ccccc1C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C20H28F2N2O2/c1-16-6-4-11-23(16)12-5-15-26-18-8-3-2-7-17(18)19(25)24-13-9-20(21,22)10-14-24/h2-3,7-8,16H,4-6,9-15H2,1H3 |
| InChIKey | DKFXVSWIGXBOCR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|