C30H29N3O3 — CID 67322694
4-phenyl-2-[4-[(3-phenylmethoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carboxylic acid (PubChem CID 67322694) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-phenyl-2-[4-[(3-phenylmethoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 4-phenyl-2-[4-[(3-phenylmethoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67322694 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 4-phenyl-2-[4-[(3-phenylmethoxyphenyl)methyl]piperazin-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2)ccnc1N1CCN(Cc2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C30H29N3O3/c34-30(35)28-27(25-11-5-2-6-12-25)14-15-31-29(28)33-18-16-32(17-19-33)21-24-10-7-13-26(20-24)36-22-23-8-3-1-4-9-23/h1-15,20H,16-19,21-22H2,(H,34,35) |
| InChIKey | UMVRNPVCRLYIFB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |