C27H31N3O2 — CID 67323534
propan-2-yl 2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-4-phenylpyridine-3-carboxylate (PubChem CID 67323534) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-4-phenylpyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-4-phenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 67323534 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | propan-2-yl 2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-4-phenylpyridine-3-carboxylate |
| SMILES | Cc1ccccc1CN1CCN(c2nccc(-c3ccccc3)c2C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C27H31N3O2/c1-20(2)32-27(31)25-24(22-10-5-4-6-11-22)13-14-28-26(25)30-17-15-29(16-18-30)19-23-12-8-7-9-21(23)3/h4-14,20H,15-19H2,1-3H3 |
| InChIKey | SRGFRQDGHNRRDJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |