About 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone
1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone (PubChem CID 67324553) has the molecular formula C6H2BrF3O2
and a molecular weight of 242.98 g/mol. Its IUPAC name is 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone |
| PubChem CID | 67324553 |
| Molecular Formula | C6H2BrF3O2 |
| Molecular Weight | 242.98 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cc(Br)co1)C(F)(F)F |
| InChI | InChI=1S/C6H2BrF3O2/c7-3-1-4(12-2-3)5(11)6(8,9)10/h1-2H |
| InChIKey | HIFAJOVCQJAQQP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.98 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone (CID 67324553) is 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone is O=C(c1cc(Br)co1)C(F)(F)F.
What is the InChIKey of 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone?
The InChIKey is HIFAJOVCQJAQQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrF3O2/c7-3-1-4(12-2-3)5(11)6(8,9)10/h1-2H.
What are the key properties of 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone?
1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone has a molecular weight of 242.98 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromofuran-2-yl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 67324553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).