C24H31ClN2O2 — CID 67325622
tert-butyl N-[1-benzyl-4-(3-chloro-4-methylphenyl)pyrrolidin-3-yl]-N-methylcarbamate (PubChem CID 67325622) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is tert-butyl N-[1-benzyl-4-(3-chloro-4-methylphenyl)pyrrolidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-benzyl-4-(3-chloro-4-methylphenyl)pyrrolidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67325622 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | tert-butyl N-[1-benzyl-4-(3-chloro-4-methylphenyl)pyrrolidin-3-yl]-N-methylcarbamate |
| SMILES | Cc1ccc(C2CN(Cc3ccccc3)CC2N(C)C(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C24H31ClN2O2/c1-17-11-12-19(13-21(17)25)20-15-27(14-18-9-7-6-8-10-18)16-22(20)26(5)23(28)29-24(2,3)4/h6-13,20,22H,14-16H2,1-5H3 |
| InChIKey | MDSQCMBUBVQXKG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |