C21H28N2O4Si — CID 67325962
2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(pyridine-3-carbonylamino)propanoic acid (PubChem CID 67325962) has the molecular formula C21H28N2O4Si and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(pyridine-3-carbonylamino)propanoic acid.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(pyridine-3-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 67325962 |
| Molecular Formula | C21H28N2O4Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(pyridine-3-carbonylamino)propanoic acid |
| SMILES | CC(NC(=O)c1cccnc1)(C(=O)O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O4Si/c1-20(2,3)28(5,6)27-17-11-9-16(10-12-17)21(4,19(25)26)23-18(24)15-8-7-13-22-14-15/h7-14H,1-6H3,(H,23,24)(H,25,26) |
| InChIKey | PMDKXALLCGQMKL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|