C16H26Cl3N5O — CID 67337955
N-(diaminomethylidene)-8-piperazin-1-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide;trihydrochloride (PubChem CID 67337955) has the molecular formula C16H26Cl3N5O and a molecular weight of 410.78 g/mol. Its IUPAC name is N-(diaminomethylidene)-8-piperazin-1-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide;trihydrochloride.
| Compound Name | N-(diaminomethylidene)-8-piperazin-1-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide;trihydrochloride |
|---|---|
| PubChem CID | 67337955 |
| Molecular Formula | C16H26Cl3N5O |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-(diaminomethylidene)-8-piperazin-1-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.NC(N)=NC(=O)c1ccc2c(c1)C(N1CCNCC1)CCC2 |
| InChI | InChI=1S/C16H23N5O.3ClH/c17-16(18)20-15(22)12-5-4-11-2-1-3-14(13(11)10-12)21-8-6-19-7-9-21;;;/h4-5,10,14,19H,1-3,6-9H2,(H4,17,18,20,22);3*1H |
| InChIKey | IMQKOSXMYSLFEN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|