C17H18BrN3O4 — CID 6734071
N'-(5-bromo-2-pyridinyl)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]butanediamide (PubChem CID 6734071) has the molecular formula C17H18BrN3O4 and a molecular weight of 408.25 g/mol. Its IUPAC name is N'-(5-bromo-2-pyridinyl)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]butanediamide.
| Compound Name | N'-(5-bromo-2-pyridinyl)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 6734071 |
| Molecular Formula | C17H18BrN3O4 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | N'-(5-bromo-2-pyridinyl)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Br)cn1)NCC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18BrN3O4/c18-12-3-6-15(19-9-12)21-17(25)8-7-16(24)20-10-14(23)11-1-4-13(22)5-2-11/h1-6,9,14,22-23H,7-8,10H2,(H,20,24)(H,19,21,25) |
| InChIKey | SQXKIJPKVVRGPJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |