About vinylphenylchlorosilane
vinylphenylchlorosilane (PubChem CID 67342203) has the molecular formula C8H8ClSi
and a molecular weight of 167.69 g/mol.
Molecular Properties
| Compound Name | vinylphenylchlorosilane |
| PubChem CID | 67342203 |
| Molecular Formula | C8H8ClSi |
| Molecular Weight | 167.69 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | — |
| SMILES | C=C[Si](Cl)c1ccccc1 |
| InChI | InChI=1S/C8H8ClSi/c1-2-10(9)8-6-4-3-5-7-8/h2-7H,1H2 |
| InChIKey | OEVGBHJDXHQCKE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze vinylphenylchlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of vinylphenylchlorosilane?
The IUPAC name of vinylphenylchlorosilane (CID 67342203) is not available.
What is the SMILES notation for vinylphenylchlorosilane?
The canonical SMILES for vinylphenylchlorosilane is C=C[Si](Cl)c1ccccc1.
What is the InChIKey of vinylphenylchlorosilane?
The InChIKey is OEVGBHJDXHQCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClSi/c1-2-10(9)8-6-4-3-5-7-8/h2-7H,1H2.
What are the key properties of vinylphenylchlorosilane?
vinylphenylchlorosilane has a molecular weight of 167.69 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for vinylphenylchlorosilane is sourced from PubChem (CID 67342203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).