C24H27N5O6S — CID 67343804
N-[4-(morpholine-4-carbonyl)cyclohexyl]-N-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide (PubChem CID 67343804) has the molecular formula C24H27N5O6S and a molecular weight of 513.58 g/mol. Its IUPAC name is N-[4-(morpholine-4-carbonyl)cyclohexyl]-N-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide.
| Compound Name | N-[4-(morpholine-4-carbonyl)cyclohexyl]-N-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 67343804 |
| Molecular Formula | C24H27N5O6S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-[4-(morpholine-4-carbonyl)cyclohexyl]-N-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
| SMILES | O=C(C1CCC(N(c2c([N+](=O)[O-])cnc3[nH]ccc23)S(=O)(=O)c2ccccc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C24H27N5O6S/c30-24(27-12-14-35-15-13-27)17-6-8-18(9-7-17)28(36(33,34)19-4-2-1-3-5-19)22-20-10-11-25-23(20)26-16-21(22)29(31)32/h1-5,10-11,16-18H,6-9,12-15H2,(H,25,26) |
| InChIKey | GSAXWSWOELMBFX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 138.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|