C18H16ClF2N3OS — CID 67346962
N-(4-chloro-2-fluorophenyl)-2-[2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide (PubChem CID 67346962) has the molecular formula C18H16ClF2N3OS and a molecular weight of 395.86 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 67346962 |
| Molecular Formula | C18H16ClF2N3OS |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[2-(3-fluorophenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide |
| SMILES | CN1/C(=N/c2cccc(F)c2)SCC1CC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H16ClF2N3OS/c1-24-14(9-17(25)23-16-6-5-11(19)7-15(16)21)10-26-18(24)22-13-4-2-3-12(20)8-13/h2-8,14H,9-10H2,1H3,(H,23,25)/b22-18- |
| InChIKey | HNNWXMZJNCAMCS-PYCFMQQDSA-N |
| XLogP | 4.68 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|