C20H21BrO5S — CID 67347603
methyl 2-[5-bromo-2-[3-(2-ethoxy-2-oxoethyl)phenoxy]phenyl]-2-methylsulfanylacetate (PubChem CID 67347603) has the molecular formula C20H21BrO5S and a molecular weight of 453.35 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-[3-(2-ethoxy-2-oxoethyl)phenoxy]phenyl]-2-methylsulfanylacetate.
| Compound Name | methyl 2-[5-bromo-2-[3-(2-ethoxy-2-oxoethyl)phenoxy]phenyl]-2-methylsulfanylacetate |
|---|---|
| PubChem CID | 67347603 |
| Molecular Formula | C20H21BrO5S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | methyl 2-[5-bromo-2-[3-(2-ethoxy-2-oxoethyl)phenoxy]phenyl]-2-methylsulfanylacetate |
| SMILES | CCOC(=O)Cc1cccc(Oc2ccc(Br)cc2C(SC)C(=O)OC)c1 |
| InChI | InChI=1S/C20H21BrO5S/c1-4-25-18(22)11-13-6-5-7-15(10-13)26-17-9-8-14(21)12-16(17)19(27-3)20(23)24-2/h5-10,12,19H,4,11H2,1-3H3 |
| InChIKey | JGYSIABSKLWKGF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |