C24H31ClFN3OS — CID 67347807
2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide (PubChem CID 67347807) has the molecular formula C24H31ClFN3OS and a molecular weight of 464.05 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67347807 |
| Molecular Formula | C24H31ClFN3OS |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide |
| SMILES | CC(C)N1/C(=N/C23CC4CC(CC(C4)C2)C3)SCC1CC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C24H31ClFN3OS/c1-14(2)29-19(9-22(30)27-21-4-3-18(25)8-20(21)26)13-31-23(29)28-24-10-15-5-16(11-24)7-17(6-15)12-24/h3-4,8,14-17,19H,5-7,9-13H2,1-2H3,(H,27,30)/b28-23- |
| InChIKey | PGUQAMSXGSWNCT-NFFVHWSESA-N |
| XLogP | 5.96 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|