C34H32F2N4O3S — CID 67348672
1-N'-[3-fluoro-4-[2-(3-methyl-3-piperidin-1-ylbut-1-ynyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 67348672) has the molecular formula C34H32F2N4O3S and a molecular weight of 614.72 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[2-(3-methyl-3-piperidin-1-ylbut-1-ynyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[2-(3-methyl-3-piperidin-1-ylbut-1-ynyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 67348672 |
| Molecular Formula | C34H32F2N4O3S |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 1-N'-[3-fluoro-4-[2-(3-methyl-3-piperidin-1-ylbut-1-ynyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)(C#Cc1cc2nccc(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3F)c2s1)N1CCCCC1 |
| InChI | InChI=1S/C34H32F2N4O3S/c1-33(2,39-18-4-3-5-19-39)14-12-25-21-27-30(44-25)29(13-17-38-27)43-28-11-10-24(20-26(28)36)40(23-8-6-22(35)7-9-23)32(42)34(15-16-34)31(37)41/h6-11,13,17,20-21H,3-5,15-16,18-19H2,1-2H3,(H2,37,41) |
| InChIKey | YNERDQLZHZRWNJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|