C31H33FN4O5S — CID 67349366
tert-butyl 4-[3-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]-2-fluorophenoxy]thieno[3,2-b]pyridin-2-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 67349366) has the molecular formula C31H33FN4O5S and a molecular weight of 592.69 g/mol. Its IUPAC name is tert-butyl 4-[3-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]-2-fluorophenoxy]thieno[3,2-b]pyridin-2-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]-2-fluorophenoxy]thieno[3,2-b]pyridin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67349366 |
| Molecular Formula | C31H33FN4O5S |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | tert-butyl 4-[3-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]-2-fluorophenoxy]thieno[3,2-b]pyridin-2-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC#Cc2cc3nccc(Oc4ccc(NC(=O)C5(C(N)=O)CC5)cc4F)c3s2)CC1 |
| InChI | InChI=1S/C31H33FN4O5S/c1-30(2,3)41-29(39)36-15-10-19(11-16-36)5-4-6-21-18-23-26(42-21)25(9-14-34-23)40-24-8-7-20(17-22(24)32)35-28(38)31(12-13-31)27(33)37/h7-9,14,17-19H,5,10-13,15-16H2,1-3H3,(H2,33,37)(H,35,38) |
| InChIKey | DMOJWIOOJBKDCN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|