C17H21N5O3 — CID 67349376
tert-butyl-[3-(4-cyano-1H-indol-3-yl)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid (PubChem CID 67349376) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is tert-butyl-[3-(4-cyano-1H-indol-3-yl)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[3-(4-cyano-1H-indol-3-yl)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67349376 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | tert-butyl-[3-(4-cyano-1H-indol-3-yl)-1-hydrazinyl-1-oxopropan-2-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C(Cc1c[nH]c2cccc(C#N)c12)C(=O)NN |
| InChI | InChI=1S/C17H21N5O3/c1-17(2,3)22(16(24)25)13(15(23)21-19)7-11-9-20-12-6-4-5-10(8-18)14(11)12/h4-6,9,13,20H,7,19H2,1-3H3,(H,21,23)(H,24,25) |
| InChIKey | OXVDSJUGNJAVLT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|