C24H32BN2O7 — CID 67354929
CID 67354929 (PubChem CID 67354929) has the molecular formula C24H32BN2O7 and a molecular weight of 471.34 g/mol.
| Compound Name | CID 67354929 |
|---|---|
| PubChem CID | 67354929 |
| Molecular Formula | C24H32BN2O7 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | — |
| SMILES | CC(C)C[C@H](N)O[B]O.O=C(O)[C@@H]1C[C@@H](Oc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19NO5.C5H13BNO2/c21-18(22)17-11-16(25-15-9-5-2-6-10-15)12-20(17)19(23)24-13-14-7-3-1-4-8-14;1-4(2)3-5(7)9-6-8/h1-10,16-17H,11-13H2,(H,21,22);4-5,8H,3,7H2,1-2H3/t16-,17+;5-/m11/s1 |
| InChIKey | PQGUHJQNNVAKMZ-TUZUDXBHSA-N |
| XLogP | 2.79 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|