C22H29BrN2O3S — CID 6735510
4-bromo-N-[1-[(2-ethoxyphenyl)methyl]pyrrolidin-3-yl]-2-ethyl-N-methylbenzenesulfonamide (PubChem CID 6735510) has the molecular formula C22H29BrN2O3S and a molecular weight of 481.46 g/mol. Its IUPAC name is 4-bromo-N-[1-[(2-ethoxyphenyl)methyl]pyrrolidin-3-yl]-2-ethyl-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[1-[(2-ethoxyphenyl)methyl]pyrrolidin-3-yl]-2-ethyl-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 6735510 |
| Molecular Formula | C22H29BrN2O3S |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 4-bromo-N-[1-[(2-ethoxyphenyl)methyl]pyrrolidin-3-yl]-2-ethyl-N-methylbenzenesulfonamide |
| SMILES | CCOc1ccccc1CN1CCC(N(C)S(=O)(=O)c2ccc(Br)cc2CC)C1 |
| InChI | InChI=1S/C22H29BrN2O3S/c1-4-17-14-19(23)10-11-22(17)29(26,27)24(3)20-12-13-25(16-20)15-18-8-6-7-9-21(18)28-5-2/h6-11,14,20H,4-5,12-13,15-16H2,1-3H3 |
| InChIKey | GTONTHBUMYPHGW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |