C28H37F2N5O — CID 67360562
3,3-bis[2-(4-fluorophenyl)-2-piperazin-1-ylethyl]pyrrolidin-2-one (PubChem CID 67360562) has the molecular formula C28H37F2N5O and a molecular weight of 497.63 g/mol. Its IUPAC name is 3,3-bis[2-(4-fluorophenyl)-2-piperazin-1-ylethyl]pyrrolidin-2-one.
| Compound Name | 3,3-bis[2-(4-fluorophenyl)-2-piperazin-1-ylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 67360562 |
| Molecular Formula | C28H37F2N5O |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 3,3-bis[2-(4-fluorophenyl)-2-piperazin-1-ylethyl]pyrrolidin-2-one |
| SMILES | O=C1NCCC1(CC(c1ccc(F)cc1)N1CCNCC1)CC(c1ccc(F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C28H37F2N5O/c29-23-5-1-21(2-6-23)25(34-15-11-31-12-16-34)19-28(9-10-33-27(28)36)20-26(35-17-13-32-14-18-35)22-3-7-24(30)8-4-22/h1-8,25-26,31-32H,9-20H2,(H,33,36) |
| InChIKey | CFCBKXFXVYUCNS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |