C36H34N4O2 — CID 6736067
[4-(3,5-diphenylpyrazol-1-yl)phenyl]-[4-[(4-prop-2-enoxyphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 6736067) has the molecular formula C36H34N4O2 and a molecular weight of 554.69 g/mol. Its IUPAC name is [4-(3,5-diphenylpyrazol-1-yl)phenyl]-[4-[(4-prop-2-enoxyphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [4-(3,5-diphenylpyrazol-1-yl)phenyl]-[4-[(4-prop-2-enoxyphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 6736067 |
| Molecular Formula | C36H34N4O2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | [4-(3,5-diphenylpyrazol-1-yl)phenyl]-[4-[(4-prop-2-enoxyphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | C=CCOc1ccc(CN2CCN(C(=O)c3ccc(-n4nc(-c5ccccc5)cc4-c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C36H34N4O2/c1-2-25-42-33-19-13-28(14-20-33)27-38-21-23-39(24-22-38)36(41)31-15-17-32(18-16-31)40-35(30-11-7-4-8-12-30)26-34(37-40)29-9-5-3-6-10-29/h2-20,26H,1,21-25,27H2 |
| InChIKey | GVKHAYLACQYHPT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|