C24H35N3O — CID 6736213
N-cyclohexyl-4-(3,5-ditert-butylpyrazol-1-yl)benzamide (PubChem CID 6736213) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is N-cyclohexyl-4-(3,5-ditert-butylpyrazol-1-yl)benzamide.
| Compound Name | N-cyclohexyl-4-(3,5-ditert-butylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 6736213 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | N-cyclohexyl-4-(3,5-ditert-butylpyrazol-1-yl)benzamide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)n(-c2ccc(C(=O)NC3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C24H35N3O/c1-23(2,3)20-16-21(24(4,5)6)27(26-20)19-14-12-17(13-15-19)22(28)25-18-10-8-7-9-11-18/h12-16,18H,7-11H2,1-6H3,(H,25,28) |
| InChIKey | WKEISJQXROAAEL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |