C15H21BrN5O+ — CID 67364024
2-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-N,N-dimethylacetamide (PubChem CID 67364024) has the molecular formula C15H21BrN5O+ and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 67364024 |
| Molecular Formula | C15H21BrN5O+ |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCC(C2=C3C=NC=C[N+]3(C)C(Br)=N2)C1 |
| InChI | InChI=1S/C15H21BrN5O/c1-19(2)13(22)10-20-6-4-11(9-20)14-12-8-17-5-7-21(12,3)15(16)18-14/h5,7-8,11H,4,6,9-10H2,1-3H3/q+1 |
| InChIKey | GKLPYPAPVPJZAF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|