About 6H-1,4-benzodiazepine-5-sulfonamide
6H-1,4-benzodiazepine-5-sulfonamide (PubChem CID 67364284) has the molecular formula C9H9N3O2S
and a molecular weight of 223.26 g/mol. Its IUPAC name is 6H-1,4-benzodiazepine-5-sulfonamide.
Molecular Properties
| Compound Name | 6H-1,4-benzodiazepine-5-sulfonamide |
| PubChem CID | 67364284 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 6H-1,4-benzodiazepine-5-sulfonamide |
| SMILES | NS(=O)(=O)C1=C2CC=CC=C2N=CC=N1 |
| InChI | InChI=1S/C9H9N3O2S/c10-15(13,14)9-7-3-1-2-4-8(7)11-5-6-12-9/h1-2,4-6H,3H2,(H2,10,13,14) |
| InChIKey | XDFAVQOISYYMPA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6H-1,4-benzodiazepine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-1,4-benzodiazepine-5-sulfonamide?
The IUPAC name of 6H-1,4-benzodiazepine-5-sulfonamide (CID 67364284) is 6H-1,4-benzodiazepine-5-sulfonamide.
What is the SMILES notation for 6H-1,4-benzodiazepine-5-sulfonamide?
The canonical SMILES for 6H-1,4-benzodiazepine-5-sulfonamide is NS(=O)(=O)C1=C2CC=CC=C2N=CC=N1.
What is the InChIKey of 6H-1,4-benzodiazepine-5-sulfonamide?
The InChIKey is XDFAVQOISYYMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S/c10-15(13,14)9-7-3-1-2-4-8(7)11-5-6-12-9/h1-2,4-6H,3H2,(H2,10,13,14).
What are the key properties of 6H-1,4-benzodiazepine-5-sulfonamide?
6H-1,4-benzodiazepine-5-sulfonamide has a molecular weight of 223.26 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-1,4-benzodiazepine-5-sulfonamide is sourced from PubChem (CID 67364284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).