C12H18O2 — CID 67368463
1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]propan-1-one (PubChem CID 67368463) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]propan-1-one.
| Compound Name | 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]propan-1-one |
|---|---|
| PubChem CID | 67368463 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]propan-1-one |
| SMILES | CCC(=O)C1(COC)C=CCC=C1C |
| InChI | InChI=1S/C12H18O2/c1-4-11(13)12(9-14-3)8-6-5-7-10(12)2/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | NWFPSOFMFNSCAW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|