C15H24O2 — CID 67369557
1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 67369557) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 67369557 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-[1-(methoxymethyl)-2-methylcyclohexa-2,5-dien-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | COCC1(C(=O)CC(C)(C)C)C=CCC=C1C |
| InChI | InChI=1S/C15H24O2/c1-12-8-6-7-9-15(12,11-17-5)13(16)10-14(2,3)4/h7-9H,6,10-11H2,1-5H3 |
| InChIKey | QVIGSJRQAMYUCD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|