C6H12ClF2NO — CID 67371997
(4,4-difluoropiperidin-3-yl)methanol;hydrochloride (PubChem CID 67371997) has the molecular formula C6H12ClF2NO and a molecular weight of 187.62 g/mol. Its IUPAC name is (4,4-difluoropiperidin-3-yl)methanol;hydrochloride.
| Compound Name | (4,4-difluoropiperidin-3-yl)methanol;hydrochloride |
|---|---|
| PubChem CID | 67371997 |
| Molecular Formula | C6H12ClF2NO |
| Molecular Weight | 187.62 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | (4,4-difluoropiperidin-3-yl)methanol;hydrochloride |
| SMILES | Cl.OCC1CNCCC1(F)F |
| InChI | InChI=1S/C6H11F2NO.ClH/c7-6(8)1-2-9-3-5(6)4-10;/h5,9-10H,1-4H2;1H |
| InChIKey | FZLKYPPNCKYROE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.62 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |