C9H12ClN3 — CID 67376397
4-hydrazinyl-3,5-dimethylbenzonitrile;hydrochloride (PubChem CID 67376397) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 4-hydrazinyl-3,5-dimethylbenzonitrile;hydrochloride.
| Compound Name | 4-hydrazinyl-3,5-dimethylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 67376397 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 4-hydrazinyl-3,5-dimethylbenzonitrile;hydrochloride |
| SMILES | Cc1cc(C#N)cc(C)c1NN.Cl |
| InChI | InChI=1S/C9H11N3.ClH/c1-6-3-8(5-10)4-7(2)9(6)12-11;/h3-4,12H,11H2,1-2H3;1H |
| InChIKey | MYSMMQQBCVHJTB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|